C8H19N3O3S — CID 159549179
2-[[[2-amino-3-(methylamino)propoxy]amino]methyl]-3-sulfanylpropanoic acid (PubChem CID 159549179) has the molecular formula C8H19N3O3S and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-[[[2-amino-3-(methylamino)propoxy]amino]methyl]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[[2-amino-3-(methylamino)propoxy]amino]methyl]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 159549179 |
| Molecular Formula | C8H19N3O3S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-[[[2-amino-3-(methylamino)propoxy]amino]methyl]-3-sulfanylpropanoic acid |
| SMILES | CNCC(N)CONCC(CS)C(=O)O |
| InChI | InChI=1S/C8H19N3O3S/c1-10-3-7(9)4-14-11-2-6(5-15)8(12)13/h6-7,10-11,15H,2-5,9H2,1H3,(H,12,13) |
| InChIKey | GKUKBTICGFEDLT-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|