C6H12N2O3 — CID 89475350
4-amino-2-(methylaminomethyl)-4-oxobutanoic acid (PubChem CID 89475350) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is 4-amino-2-(methylaminomethyl)-4-oxobutanoic acid.
| Compound Name | 4-amino-2-(methylaminomethyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89475350 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 4-amino-2-(methylaminomethyl)-4-oxobutanoic acid |
| SMILES | CNCC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C6H12N2O3/c1-8-3-4(6(10)11)2-5(7)9/h4,8H,2-3H2,1H3,(H2,7,9)(H,10,11) |
| InChIKey | XDIKLFXQLJBKIF-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |