C4H13N3 — CID 155906228
(2R)-3-N-methylpropane-1,2,3-triamine (PubChem CID 155906228) has the molecular formula C4H13N3 and a molecular weight of 103.17 g/mol. Its IUPAC name is (2R)-3-N-methylpropane-1,2,3-triamine.
| Compound Name | (2R)-3-N-methylpropane-1,2,3-triamine |
|---|---|
| PubChem CID | 155906228 |
| Molecular Formula | C4H13N3 |
| Molecular Weight | 103.17 g/mol |
| Exact Mass | 103.11 |
| IUPAC Name | (2R)-3-N-methylpropane-1,2,3-triamine |
| SMILES | CNC[C@H](N)CN |
| InChI | InChI=1S/C4H13N3/c1-7-3-4(6)2-5/h4,7H,2-3,5-6H2,1H3/t4-/m1/s1 |
| InChIKey | CANSVBFJDVVCTO-SCSAIBSYSA-N |
| XLogP | -1.51 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 103.17 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |