C6H15FN2 — CID 142196166
2-(1-fluoroethyl)-N'-methylpropane-1,3-diamine (PubChem CID 142196166) has the molecular formula C6H15FN2 and a molecular weight of 134.20 g/mol. Its IUPAC name is 2-(1-fluoroethyl)-N'-methylpropane-1,3-diamine.
| Compound Name | 2-(1-fluoroethyl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 142196166 |
| Molecular Formula | C6H15FN2 |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.12 |
| IUPAC Name | 2-(1-fluoroethyl)-N'-methylpropane-1,3-diamine |
| SMILES | CNCC(CN)C(C)F |
| InChI | InChI=1S/C6H15FN2/c1-5(7)6(3-8)4-9-2/h5-6,9H,3-4,8H2,1-2H3 |
| InChIKey | VJSOZFQATRKGON-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |