C10H28N2 — CID 144511427
ethane;2-ethyl-N'-methylpropane-1,3-diamine (PubChem CID 144511427) has the molecular formula C10H28N2 and a molecular weight of 176.35 g/mol. Its IUPAC name is ethane;2-ethyl-N'-methylpropane-1,3-diamine.
| Compound Name | ethane;2-ethyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 144511427 |
| Molecular Formula | C10H28N2 |
| Molecular Weight | 176.35 g/mol |
| Exact Mass | 176.23 |
| IUPAC Name | ethane;2-ethyl-N'-methylpropane-1,3-diamine |
| SMILES | CC.CC.CCC(CN)CNC |
| InChI | InChI=1S/C6H16N2.2C2H6/c1-3-6(4-7)5-8-2;2*1-2/h6,8H,3-5,7H2,1-2H3;2*1-2H3 |
| InChIKey | IEZBNISCDHOYPY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |