C5H14N2 — CID 14499053
2-ethylpropane-1,3-diamine (PubChem CID 14499053) has the molecular formula C5H14N2 and a molecular weight of 102.18 g/mol. Its IUPAC name is 2-ethylpropane-1,3-diamine.
| Compound Name | 2-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 14499053 |
| Molecular Formula | C5H14N2 |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.12 |
| IUPAC Name | 2-ethylpropane-1,3-diamine |
| SMILES | CCC(CN)CN |
| InChI | InChI=1S/C5H14N2/c1-2-5(3-6)4-7/h5H,2-4,6-7H2,1H3 |
| InChIKey | GLXTZKCNKVYLPF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |