C11H29N3 — CID 162225203
2,4-diethylpentane-1,5-diamine;ethanamine (PubChem CID 162225203) has the molecular formula C11H29N3 and a molecular weight of 203.37 g/mol. Its IUPAC name is 2,4-diethylpentane-1,5-diamine;ethanamine.
| Compound Name | 2,4-diethylpentane-1,5-diamine;ethanamine |
|---|---|
| PubChem CID | 162225203 |
| Molecular Formula | C11H29N3 |
| Molecular Weight | 203.37 g/mol |
| Exact Mass | 203.24 |
| IUPAC Name | 2,4-diethylpentane-1,5-diamine;ethanamine |
| SMILES | CCC(CN)CC(CC)CN.CCN |
| InChI | InChI=1S/C9H22N2.C2H7N/c1-3-8(6-10)5-9(4-2)7-11;1-2-3/h8-9H,3-7,10-11H2,1-2H3;2-3H2,1H3 |
| InChIKey | ZUQVQRTVISNKIB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |