C10H24N2 — CID 170202582
2-ethyl-N',N',4-trimethylpentane-1,5-diamine (PubChem CID 170202582) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is 2-ethyl-N',N',4-trimethylpentane-1,5-diamine.
| Compound Name | 2-ethyl-N',N',4-trimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 170202582 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 2-ethyl-N',N',4-trimethylpentane-1,5-diamine |
| SMILES | CCC(CN)CC(C)CN(C)C |
| InChI | InChI=1S/C10H24N2/c1-5-10(7-11)6-9(2)8-12(3)4/h9-10H,5-8,11H2,1-4H3 |
| InChIKey | PHGRTIPUMVQWEG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |