C8H20NRf- — CID 166075746
carbanide;rutherfordium;N,N,2-trimethylbutan-1-amine (PubChem CID 166075746) has the molecular formula C8H20NRf- and a molecular weight of 397.26 g/mol. Its IUPAC name is carbanide;rutherfordium;N,N,2-trimethylbutan-1-amine.
| Compound Name | carbanide;rutherfordium;N,N,2-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 166075746 |
| Molecular Formula | C8H20NRf- |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | carbanide;rutherfordium;N,N,2-trimethylbutan-1-amine |
| SMILES | CCC(C)CN(C)C.[CH3-].[Rf] |
| InChI | InChI=1S/C7H17N.CH3.Rf/c1-5-7(2)6-8(3)4;;/h7H,5-6H2,1-4H3;1H3;/q;-1; |
| InChIKey | QKDKUNXLXYLUIE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|