C9H23N — CID 178101295
ethane;(2R)-N,N,2-trimethylbutan-1-amine (PubChem CID 178101295) has the molecular formula C9H23N and a molecular weight of 145.29 g/mol. Its IUPAC name is ethane;(2R)-N,N,2-trimethylbutan-1-amine.
| Compound Name | ethane;(2R)-N,N,2-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 178101295 |
| Molecular Formula | C9H23N |
| Molecular Weight | 145.29 g/mol |
| Exact Mass | 145.18 |
| IUPAC Name | ethane;(2R)-N,N,2-trimethylbutan-1-amine |
| SMILES | CC.CC[C@@H](C)CN(C)C |
| InChI | InChI=1S/C7H17N.C2H6/c1-5-7(2)6-8(3)4;1-2/h7H,5-6H2,1-4H3;1-2H3/t7-;/m1./s1 |
| InChIKey | FWVLRPGBDOVIMV-OGFXRTJISA-N |
| XLogP | 2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |