C13H35N — CID 144720352
ethane;N,N,2-trimethylbutan-1-amine (PubChem CID 144720352) has the molecular formula C13H35N and a molecular weight of 205.43 g/mol. Its IUPAC name is ethane;N,N,2-trimethylbutan-1-amine.
| Compound Name | ethane;N,N,2-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 144720352 |
| Molecular Formula | C13H35N |
| Molecular Weight | 205.43 g/mol |
| Exact Mass | 205.28 |
| IUPAC Name | ethane;N,N,2-trimethylbutan-1-amine |
| SMILES | CC.CC.CC.CCC(C)CN(C)C |
| InChI | InChI=1S/C7H17N.3C2H6/c1-5-7(2)6-8(3)4;3*1-2/h7H,5-6H2,1-4H3;3*1-2H3 |
| InChIKey | OCTNCLXSZJWWKJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |