C11H28N2 — CID 142151966
N',2-diethyl-N'-methylpropane-1,3-diamine;propane (PubChem CID 142151966) has the molecular formula C11H28N2 and a molecular weight of 188.36 g/mol. Its IUPAC name is N',2-diethyl-N'-methylpropane-1,3-diamine;propane.
| Compound Name | N',2-diethyl-N'-methylpropane-1,3-diamine;propane |
|---|---|
| PubChem CID | 142151966 |
| Molecular Formula | C11H28N2 |
| Molecular Weight | 188.36 g/mol |
| Exact Mass | 188.23 |
| IUPAC Name | N',2-diethyl-N'-methylpropane-1,3-diamine;propane |
| SMILES | CCC.CCC(CN)CN(C)CC |
| InChI | InChI=1S/C8H20N2.C3H8/c1-4-8(6-9)7-10(3)5-2;1-3-2/h8H,4-7,9H2,1-3H3;3H2,1-2H3 |
| InChIKey | MHZZZPRWMREGNM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |