C7H18N2 — CID 25219171
N'-ethyl-N',2-dimethylpropane-1,3-diamine (PubChem CID 25219171) has the molecular formula C7H18N2 and a molecular weight of 130.23 g/mol. Its IUPAC name is N'-ethyl-N',2-dimethylpropane-1,3-diamine.
| Compound Name | N'-ethyl-N',2-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 25219171 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | N'-ethyl-N',2-dimethylpropane-1,3-diamine |
| SMILES | CCN(C)CC(C)CN |
| InChI | InChI=1S/C7H18N2/c1-4-9(3)6-7(2)5-8/h7H,4-6,8H2,1-3H3 |
| InChIKey | SICIHXOPFHRGOG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |