About N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine
N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine (PubChem CID 81080701) has the molecular formula C10H24N2
and a molecular weight of 172.32 g/mol. Its IUPAC name is N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine.
Analyze N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine?
The IUPAC name of N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine (CID 81080701) is N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine.
What is the SMILES notation for N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine?
The canonical SMILES for N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine is CC(C)CN(C)CCC(C)CN.
What is the InChIKey of N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine?
The InChIKey is USPYKAIKJIUTNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2/c1-9(2)8-12(4)6-5-10(3)7-11/h9-10H,5-8,11H2,1-4H3.
What are the key properties of N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine?
N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine has a molecular weight of 172.32 g/mol, XLogP of 1.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',2-dimethyl-N'-(2-methylpropyl)butane-1,4-diamine is sourced from PubChem (CID 81080701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).