C11H29N — CID 143400672
ethane;N-ethyl-N,2-dimethylpropan-1-amine (PubChem CID 143400672) has the molecular formula C11H29N and a molecular weight of 175.36 g/mol. Its IUPAC name is ethane;N-ethyl-N,2-dimethylpropan-1-amine.
| Compound Name | ethane;N-ethyl-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 143400672 |
| Molecular Formula | C11H29N |
| Molecular Weight | 175.36 g/mol |
| Exact Mass | 175.23 |
| IUPAC Name | ethane;N-ethyl-N,2-dimethylpropan-1-amine |
| SMILES | CC.CC.CCN(C)CC(C)C |
| InChI | InChI=1S/C7H17N.2C2H6/c1-5-8(4)6-7(2)3;2*1-2/h7H,5-6H2,1-4H3;2*1-2H3 |
| InChIKey | CTQUGCULAWYRMD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |