About N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine
N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine (PubChem CID 177032219) has the molecular formula C8H18FN
and a molecular weight of 147.24 g/mol. Its IUPAC name is N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine |
| PubChem CID | 177032219 |
| Molecular Formula | C8H18FN |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.14 |
| IUPAC Name | N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine |
| SMILES | CC(C)CN(C)CC(C)F |
| InChI | InChI=1S/C8H18FN/c1-7(2)5-10(4)6-8(3)9/h7-8H,5-6H2,1-4H3 |
| InChIKey | YQBGVMMENDYITP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine?
The IUPAC name of N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine (CID 177032219) is N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine.
What is the SMILES notation for N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine?
The canonical SMILES for N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine is CC(C)CN(C)CC(C)F.
What is the InChIKey of N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine?
The InChIKey is YQBGVMMENDYITP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18FN/c1-7(2)5-10(4)6-8(3)9/h7-8H,5-6H2,1-4H3.
What are the key properties of N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine?
N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine has a molecular weight of 147.24 g/mol, XLogP of 1.93, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoropropyl)-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 177032219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).