C8H18FN — CID 170688420
2-fluoro-N,N,4-trimethylpentan-1-amine (PubChem CID 170688420) has the molecular formula C8H18FN and a molecular weight of 147.24 g/mol. Its IUPAC name is 2-fluoro-N,N,4-trimethylpentan-1-amine.
| Compound Name | 2-fluoro-N,N,4-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 170688420 |
| Molecular Formula | C8H18FN |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.14 |
| IUPAC Name | 2-fluoro-N,N,4-trimethylpentan-1-amine |
| SMILES | CC(C)CC(F)CN(C)C |
| InChI | InChI=1S/C8H18FN/c1-7(2)5-8(9)6-10(3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | ZYVSVMMEDHSERE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |