C8H21N3O2S — CID 112689006
1-(dimethylamino)-4-methyl-2-(sulfamoylamino)pentane (PubChem CID 112689006) has the molecular formula C8H21N3O2S and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-(dimethylamino)-4-methyl-2-(sulfamoylamino)pentane.
| Compound Name | 1-(dimethylamino)-4-methyl-2-(sulfamoylamino)pentane |
|---|---|
| PubChem CID | 112689006 |
| Molecular Formula | C8H21N3O2S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-(dimethylamino)-4-methyl-2-(sulfamoylamino)pentane |
| SMILES | CC(C)CC(CN(C)C)NS(N)(=O)=O |
| InChI | InChI=1S/C8H21N3O2S/c1-7(2)5-8(6-11(3)4)10-14(9,12)13/h7-8,10H,5-6H2,1-4H3,(H2,9,12,13) |
| InChIKey | HXBNERVNSBVAER-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |