About N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine
N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine (PubChem CID 126663851) has the molecular formula C7H15F2N
and a molecular weight of 151.20 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine.
Analyze N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine?
The IUPAC name of N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine (CID 126663851) is N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine.
What is the SMILES notation for N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine?
The canonical SMILES for N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine is CC(C)CN(C)CC(F)F.
What is the InChIKey of N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine?
The InChIKey is IRVOCFJUHLECNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F2N/c1-6(2)4-10(3)5-7(8)9/h6-7H,4-5H2,1-3H3.
What are the key properties of N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine?
N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine has a molecular weight of 151.20 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 126663851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).