C3H6F2NO- — CID 126664092
2,2-difluoro-N-methyl-N-oxidoethanamine (PubChem CID 126664092) has the molecular formula C3H6F2NO- and a molecular weight of 110.08 g/mol. Its IUPAC name is 2,2-difluoro-N-methyl-N-oxidoethanamine.
| Compound Name | 2,2-difluoro-N-methyl-N-oxidoethanamine |
|---|---|
| PubChem CID | 126664092 |
| Molecular Formula | C3H6F2NO- |
| Molecular Weight | 110.08 g/mol |
| Exact Mass | 110.04 |
| IUPAC Name | 2,2-difluoro-N-methyl-N-oxidoethanamine |
| SMILES | CN([O-])CC(F)F |
| InChI | InChI=1S/C3H6F2NO/c1-6(7)2-3(4)5/h3H,2H2,1H3/q-1 |
| InChIKey | CXFXLEXGZLUJKH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.08 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|