C9H10F3NO4S2 — CID 114791761
4-[2,2-difluoroethyl(methyl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 114791761) has the molecular formula C9H10F3NO4S2 and a molecular weight of 317.31 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(methyl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-[2,2-difluoroethyl(methyl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114791761 |
| Molecular Formula | C9H10F3NO4S2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 4-[2,2-difluoroethyl(methyl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | CN(CC(F)F)S(=O)(=O)c1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C9H10F3NO4S2/c1-13(6-9(10)11)19(16,17)8-4-2-7(3-5-8)18(12,14)15/h2-5,9H,6H2,1H3 |
| InChIKey | ZANPYBQRYFPTPZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |