C12H18FNO5S2 — CID 114791714
4-[methyl(2-propan-2-yloxyethyl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 114791714) has the molecular formula C12H18FNO5S2 and a molecular weight of 339.41 g/mol. Its IUPAC name is 4-[methyl(2-propan-2-yloxyethyl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-[methyl(2-propan-2-yloxyethyl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114791714 |
| Molecular Formula | C12H18FNO5S2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 4-[methyl(2-propan-2-yloxyethyl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | CC(C)OCCN(C)S(=O)(=O)c1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C12H18FNO5S2/c1-10(2)19-9-8-14(3)21(17,18)12-6-4-11(5-7-12)20(13,15)16/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | KJMPORNXFKVKLR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |