C14H24N2O3S — CID 103171665
2-amino-N,3,6-trimethyl-N-(2-propan-2-yloxyethyl)benzenesulfonamide (PubChem CID 103171665) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is 2-amino-N,3,6-trimethyl-N-(2-propan-2-yloxyethyl)benzenesulfonamide.
| Compound Name | 2-amino-N,3,6-trimethyl-N-(2-propan-2-yloxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103171665 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-amino-N,3,6-trimethyl-N-(2-propan-2-yloxyethyl)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(C)CCOC(C)C)c1N |
| InChI | InChI=1S/C14H24N2O3S/c1-10(2)19-9-8-16(5)20(17,18)14-12(4)7-6-11(3)13(14)15/h6-7,10H,8-9,15H2,1-5H3 |
| InChIKey | PRCNTMOTWNYTCP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|