C12H19NO3S — CID 80708286
N-methyl-N-(2-propan-2-yloxyethyl)benzenesulfonamide (PubChem CID 80708286) has the molecular formula C12H19NO3S and a molecular weight of 257.36 g/mol. Its IUPAC name is N-methyl-N-(2-propan-2-yloxyethyl)benzenesulfonamide.
| Compound Name | N-methyl-N-(2-propan-2-yloxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 80708286 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-methyl-N-(2-propan-2-yloxyethyl)benzenesulfonamide |
| SMILES | CC(C)OCCN(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H19NO3S/c1-11(2)16-10-9-13(3)17(14,15)12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3 |
| InChIKey | UYLWRZJRBZLURK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |