About 3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine
3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine (PubChem CID 63223427) has the molecular formula C7H16F2N2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine.
Analyze 3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine?
The IUPAC name of 3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine (CID 63223427) is 3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine.
What is the SMILES notation for 3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine?
The canonical SMILES for 3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine is CC(CCN)N(C)CC(F)F.
What is the InChIKey of 3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine?
The InChIKey is KCAHORHSRIANPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16F2N2/c1-6(3-4-10)11(2)5-7(8)9/h6-7H,3-5,10H2,1-2H3.
What are the key properties of 3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine?
3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine has a molecular weight of 166.22 g/mol, XLogP of 0.92, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(2,2-difluoroethyl)-3-N-methylbutane-1,3-diamine is sourced from PubChem (CID 63223427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).