C7H15F2NO — CID 115868925
3-[2,2-difluoroethyl(methyl)amino]butan-2-ol (PubChem CID 115868925) has the molecular formula C7H15F2NO and a molecular weight of 167.20 g/mol. Its IUPAC name is 3-[2,2-difluoroethyl(methyl)amino]butan-2-ol.
| Compound Name | 3-[2,2-difluoroethyl(methyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 115868925 |
| Molecular Formula | C7H15F2NO |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-[2,2-difluoroethyl(methyl)amino]butan-2-ol |
| SMILES | CC(O)C(C)N(C)CC(F)F |
| InChI | InChI=1S/C7H15F2NO/c1-5(6(2)11)10(3)4-7(8)9/h5-7,11H,4H2,1-3H3 |
| InChIKey | HSUNMOAULMINIF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |