C6H13F2NO2 — CID 115773225
3-[2,2-difluoroethyl(methyl)amino]propane-1,2-diol (PubChem CID 115773225) has the molecular formula C6H13F2NO2 and a molecular weight of 169.17 g/mol. Its IUPAC name is 3-[2,2-difluoroethyl(methyl)amino]propane-1,2-diol.
| Compound Name | 3-[2,2-difluoroethyl(methyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 115773225 |
| Molecular Formula | C6H13F2NO2 |
| Molecular Weight | 169.17 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 3-[2,2-difluoroethyl(methyl)amino]propane-1,2-diol |
| SMILES | CN(CC(F)F)CC(O)CO |
| InChI | InChI=1S/C6H13F2NO2/c1-9(3-6(7)8)2-5(11)4-10/h5-6,10-11H,2-4H2,1H3 |
| InChIKey | XKHVZTQQZZLQSY-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.17 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |