C8H18F2N2 — CID 145168742
N-(2,2-difluoroethyl)-N-methylazetidin-3-amine;ethane (PubChem CID 145168742) has the molecular formula C8H18F2N2 and a molecular weight of 180.24 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-methylazetidin-3-amine;ethane.
| Compound Name | N-(2,2-difluoroethyl)-N-methylazetidin-3-amine;ethane |
|---|---|
| PubChem CID | 145168742 |
| Molecular Formula | C8H18F2N2 |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-methylazetidin-3-amine;ethane |
| SMILES | CC.CN(CC(F)F)C1CNC1 |
| InChI | InChI=1S/C6H12F2N2.C2H6/c1-10(4-6(7)8)5-2-9-3-5;1-2/h5-6,9H,2-4H2,1H3;1-2H3 |
| InChIKey | LRIKYTAWBHHOHD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |