C6H12F2N2S — CID 60923206
3-[2,2-difluoroethyl(methyl)amino]propanethioamide (PubChem CID 60923206) has the molecular formula C6H12F2N2S and a molecular weight of 182.24 g/mol. Its IUPAC name is 3-[2,2-difluoroethyl(methyl)amino]propanethioamide.
| Compound Name | 3-[2,2-difluoroethyl(methyl)amino]propanethioamide |
|---|---|
| PubChem CID | 60923206 |
| Molecular Formula | C6H12F2N2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 3-[2,2-difluoroethyl(methyl)amino]propanethioamide |
| SMILES | CN(CCC(N)=S)CC(F)F |
| InChI | InChI=1S/C6H12F2N2S/c1-10(4-5(7)8)3-2-6(9)11/h5H,2-4H2,1H3,(H2,9,11) |
| InChIKey | CAJVXGFCUYWVCO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|