C8H16F2N2OS — CID 107479923
3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide (PubChem CID 107479923) has the molecular formula C8H16F2N2OS and a molecular weight of 226.29 g/mol. Its IUPAC name is 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide.
| Compound Name | 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide |
|---|---|
| PubChem CID | 107479923 |
| Molecular Formula | C8H16F2N2OS |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanethioamide |
| SMILES | CC(CC(N)=S)N(CCO)CC(F)F |
| InChI | InChI=1S/C8H16F2N2OS/c1-6(4-8(11)14)12(2-3-13)5-7(9)10/h6-7,13H,2-5H2,1H3,(H2,11,14) |
| InChIKey | GRLUXODURGPFEW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|