C10H22N2OS — CID 79381834
3-[ethyl-(2-hydroxy-2-methylpropyl)amino]butanethioamide (PubChem CID 79381834) has the molecular formula C10H22N2OS and a molecular weight of 218.37 g/mol. Its IUPAC name is 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]butanethioamide.
| Compound Name | 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]butanethioamide |
|---|---|
| PubChem CID | 79381834 |
| Molecular Formula | C10H22N2OS |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]butanethioamide |
| SMILES | CCN(CC(C)(C)O)C(C)CC(N)=S |
| InChI | InChI=1S/C10H22N2OS/c1-5-12(7-10(3,4)13)8(2)6-9(11)14/h8,13H,5-7H2,1-4H3,(H2,11,14) |
| InChIKey | JUVDMMSREUQHCD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|