C11H24N2OS — CID 61484284
3-[methyl-[2-(3-methylbutoxy)ethyl]amino]propanethioamide (PubChem CID 61484284) has the molecular formula C11H24N2OS and a molecular weight of 232.39 g/mol. Its IUPAC name is 3-[methyl-[2-(3-methylbutoxy)ethyl]amino]propanethioamide.
| Compound Name | 3-[methyl-[2-(3-methylbutoxy)ethyl]amino]propanethioamide |
|---|---|
| PubChem CID | 61484284 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-[methyl-[2-(3-methylbutoxy)ethyl]amino]propanethioamide |
| SMILES | CC(C)CCOCCN(C)CCC(N)=S |
| InChI | InChI=1S/C11H24N2OS/c1-10(2)5-8-14-9-7-13(3)6-4-11(12)15/h10H,4-9H2,1-3H3,(H2,12,15) |
| InChIKey | ZUVLIANTBGBIDR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|