C13H28N2S — CID 83155682
3-[4-methylpentyl(2-methylpropyl)amino]propanethioamide (PubChem CID 83155682) has the molecular formula C13H28N2S and a molecular weight of 244.45 g/mol. Its IUPAC name is 3-[4-methylpentyl(2-methylpropyl)amino]propanethioamide.
| Compound Name | 3-[4-methylpentyl(2-methylpropyl)amino]propanethioamide |
|---|---|
| PubChem CID | 83155682 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 3-[4-methylpentyl(2-methylpropyl)amino]propanethioamide |
| SMILES | CC(C)CCCN(CCC(N)=S)CC(C)C |
| InChI | InChI=1S/C13H28N2S/c1-11(2)6-5-8-15(10-12(3)4)9-7-13(14)16/h11-12H,5-10H2,1-4H3,(H2,14,16) |
| InChIKey | SEXUIRYYSTYENP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|