About N,N-dimethylmethanamine;fluoroform
N,N-dimethylmethanamine;fluoroform (PubChem CID 171924613) has the molecular formula C4H10F3N
and a molecular weight of 129.12 g/mol. Its IUPAC name is N,N-dimethylmethanamine;fluoroform.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;fluoroform |
| PubChem CID | 171924613 |
| Molecular Formula | C4H10F3N |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | N,N-dimethylmethanamine;fluoroform |
| SMILES | CN(C)C.FC(F)F |
| InChI | InChI=1S/C3H9N.CHF3/c1-4(2)3;2-1(3)4/h1-3H3;1H |
| InChIKey | IPZVBXNQMFRYCS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylmethanamine;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;fluoroform?
The IUPAC name of N,N-dimethylmethanamine;fluoroform (CID 171924613) is N,N-dimethylmethanamine;fluoroform.
What is the SMILES notation for N,N-dimethylmethanamine;fluoroform?
The canonical SMILES for N,N-dimethylmethanamine;fluoroform is CN(C)C.FC(F)F.
What is the InChIKey of N,N-dimethylmethanamine;fluoroform?
The InChIKey is IPZVBXNQMFRYCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.CHF3/c1-4(2)3;2-1(3)4/h1-3H3;1H.
What are the key properties of N,N-dimethylmethanamine;fluoroform?
N,N-dimethylmethanamine;fluoroform has a molecular weight of 129.12 g/mol, XLogP of 1.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;fluoroform is sourced from PubChem (CID 171924613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).