About fluoroform;methanol
fluoroform;methanol (PubChem CID 161033158) has the molecular formula C2H5F3O
and a molecular weight of 102.05 g/mol. Its IUPAC name is fluoroform;methanol.
Molecular Properties
| Compound Name | fluoroform;methanol |
| PubChem CID | 161033158 |
| Molecular Formula | C2H5F3O |
| Molecular Weight | 102.05 g/mol |
| Exact Mass | 102.03 |
| IUPAC Name | fluoroform;methanol |
| SMILES | CO.FC(F)F |
| InChI | InChI=1S/CHF3.CH4O/c2-1(3)4;1-2/h1H;2H,1H3 |
| InChIKey | TZWVZSVXLWFKKI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.05 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze fluoroform;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;methanol?
The IUPAC name of fluoroform;methanol (CID 161033158) is fluoroform;methanol.
What is the SMILES notation for fluoroform;methanol?
The canonical SMILES for fluoroform;methanol is CO.FC(F)F.
What is the InChIKey of fluoroform;methanol?
The InChIKey is TZWVZSVXLWFKKI-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3.CH4O/c2-1(3)4;1-2/h1H;2H,1H3.
What are the key properties of fluoroform;methanol?
fluoroform;methanol has a molecular weight of 102.05 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;methanol is sourced from PubChem (CID 161033158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).