About fluoroform;silicic acid
fluoroform;silicic acid (PubChem CID 159514370) has the molecular formula CH5F3O4Si
and a molecular weight of 166.13 g/mol. Its IUPAC name is fluoroform;silicic acid.
Molecular Properties
| Compound Name | fluoroform;silicic acid |
| PubChem CID | 159514370 |
| Molecular Formula | CH5F3O4Si |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 165.99 |
| IUPAC Name | fluoroform;silicic acid |
| SMILES | FC(F)F.O[Si](O)(O)O |
| InChI | InChI=1S/CHF3.H4O4Si/c2-1(3)4;1-5(2,3)4/h1H;1-4H |
| InChIKey | MAZOPKUWEVGEDE-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluoroform;silicic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;silicic acid?
The IUPAC name of fluoroform;silicic acid (CID 159514370) is fluoroform;silicic acid.
What is the SMILES notation for fluoroform;silicic acid?
The canonical SMILES for fluoroform;silicic acid is FC(F)F.O[Si](O)(O)O.
What is the InChIKey of fluoroform;silicic acid?
The InChIKey is MAZOPKUWEVGEDE-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3.H4O4Si/c2-1(3)4;1-5(2,3)4/h1H;1-4H.
What are the key properties of fluoroform;silicic acid?
fluoroform;silicic acid has a molecular weight of 166.13 g/mol, XLogP of -1.43, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;silicic acid is sourced from PubChem (CID 159514370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).