fluoroform;silicic acid

CH5F3O4Si — CID 159514370

IUPACfluoroform;silicic acid
SMILESFC(F)F.O[Si](O)(O)O
InChIInChI=1S/CHF3.H4O4Si/c2-1(3)4;1-5(2,3)4/h1H;1-4H
InChIKeyMAZOPKUWEVGEDE-UHFFFAOYSA-N
MW166.13 g/mol
LogP-1.43
Rot. Bonds

About fluoroform;silicic acid

fluoroform;silicic acid (PubChem CID 159514370) has the molecular formula CH5F3O4Si and a molecular weight of 166.13 g/mol. Its IUPAC name is fluoroform;silicic acid.

Molecular Properties

Compound Namefluoroform;silicic acid
PubChem CID159514370
Molecular FormulaCH5F3O4Si
Molecular Weight166.13 g/mol
Exact Mass165.99
IUPAC Namefluoroform;silicic acid
SMILESFC(F)F.O[Si](O)(O)O
InChIInChI=1S/CHF3.H4O4Si/c2-1(3)4;1-5(2,3)4/h1H;1-4H
InChIKeyMAZOPKUWEVGEDE-UHFFFAOYSA-N
XLogP-1.43
TPSA80.92 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.13
LogP ≤ 5-1.43
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze fluoroform;silicic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fluoroform;silicic acid?
The IUPAC name of fluoroform;silicic acid (CID 159514370) is fluoroform;silicic acid.
What is the SMILES notation for fluoroform;silicic acid?
The canonical SMILES for fluoroform;silicic acid is FC(F)F.O[Si](O)(O)O.
What is the InChIKey of fluoroform;silicic acid?
The InChIKey is MAZOPKUWEVGEDE-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3.H4O4Si/c2-1(3)4;1-5(2,3)4/h1H;1-4H.
What are the key properties of fluoroform;silicic acid?
fluoroform;silicic acid has a molecular weight of 166.13 g/mol, XLogP of -1.43, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;silicic acid is sourced from PubChem (CID 159514370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).