About silicic acid;vanadium
silicic acid;vanadium (PubChem CID 175540804) has the molecular formula H8O8Si2V
and a molecular weight of 243.17 g/mol. Its IUPAC name is silicic acid;vanadium.
Molecular Properties
| Compound Name | silicic acid;vanadium |
| PubChem CID | 175540804 |
| Molecular Formula | H8O8Si2V |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 242.92 |
| IUPAC Name | silicic acid;vanadium |
| SMILES | O[Si](O)(O)O.O[Si](O)(O)O.[V] |
| InChI | InChI=1S/2H4O4Si.V/c2*1-5(2,3)4;/h2*1-4H; |
| InChIKey | RHOKGUFTWPKJBK-UHFFFAOYSA-N |
| XLogP | -5.22 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | -5.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silicic acid;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silicic acid;vanadium?
The IUPAC name of silicic acid;vanadium (CID 175540804) is silicic acid;vanadium.
What is the SMILES notation for silicic acid;vanadium?
The canonical SMILES for silicic acid;vanadium is O[Si](O)(O)O.O[Si](O)(O)O.[V].
What is the InChIKey of silicic acid;vanadium?
The InChIKey is RHOKGUFTWPKJBK-UHFFFAOYSA-N. The full InChI is InChI=1S/2H4O4Si.V/c2*1-5(2,3)4;/h2*1-4H;.
What are the key properties of silicic acid;vanadium?
silicic acid;vanadium has a molecular weight of 243.17 g/mol, XLogP of -5.22, 0 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for silicic acid;vanadium is sourced from PubChem (CID 175540804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).