phosphane;silane;silicic acid

H11O4PSi2 — CID 174681853

IUPACphosphane;silane;silicic acid
SMILESO[Si](O)(O)O.P.[SiH4]
InChIInChI=1S/H4O4Si.H3P.H4Si/c1-5(2,3)4;;/h1-4H;1H3;1H4
InChIKeyJROVNZGKVLUXOB-UHFFFAOYSA-N
MW162.23 g/mol
LogP-4.00
Rot. Bonds

About phosphane;silane;silicic acid

phosphane;silane;silicic acid (PubChem CID 174681853) has the molecular formula H11O4PSi2 and a molecular weight of 162.23 g/mol. Its IUPAC name is phosphane;silane;silicic acid.

Molecular Properties

Compound Namephosphane;silane;silicic acid
PubChem CID174681853
Molecular FormulaH11O4PSi2
Molecular Weight162.23 g/mol
Exact Mass161.99
IUPAC Namephosphane;silane;silicic acid
SMILESO[Si](O)(O)O.P.[SiH4]
InChIInChI=1S/H4O4Si.H3P.H4Si/c1-5(2,3)4;;/h1-4H;1H3;1H4
InChIKeyJROVNZGKVLUXOB-UHFFFAOYSA-N
XLogP-4.00
TPSA80.92 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.23
LogP ≤ 5-4.00
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze phosphane;silane;silicic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phosphane;silane;silicic acid?
The IUPAC name of phosphane;silane;silicic acid (CID 174681853) is phosphane;silane;silicic acid.
What is the SMILES notation for phosphane;silane;silicic acid?
The canonical SMILES for phosphane;silane;silicic acid is O[Si](O)(O)O.P.[SiH4].
What is the InChIKey of phosphane;silane;silicic acid?
The InChIKey is JROVNZGKVLUXOB-UHFFFAOYSA-N. The full InChI is InChI=1S/H4O4Si.H3P.H4Si/c1-5(2,3)4;;/h1-4H;1H3;1H4.
What are the key properties of phosphane;silane;silicic acid?
phosphane;silane;silicic acid has a molecular weight of 162.23 g/mol, XLogP of -4.00, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phosphane;silane;silicic acid is sourced from PubChem (CID 174681853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).