About fluoroform;pentahydrofluoride
fluoroform;pentahydrofluoride (PubChem CID 173242263) has the molecular formula CH6F8
and a molecular weight of 170.04 g/mol. Its IUPAC name is fluoroform;pentahydrofluoride.
Molecular Properties
| Compound Name | fluoroform;pentahydrofluoride |
| PubChem CID | 173242263 |
| Molecular Formula | CH6F8 |
| Molecular Weight | 170.04 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | fluoroform;pentahydrofluoride |
| SMILES | F.F.F.F.F.FC(F)F |
| InChI | InChI=1S/CHF3.5FH/c2-1(3)4;;;;;/h1H;5*1H |
| InChIKey | SWQOMIDBKXUIMD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.04 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze fluoroform;pentahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;pentahydrofluoride?
The IUPAC name of fluoroform;pentahydrofluoride (CID 173242263) is fluoroform;pentahydrofluoride.
What is the SMILES notation for fluoroform;pentahydrofluoride?
The canonical SMILES for fluoroform;pentahydrofluoride is F.F.F.F.F.FC(F)F.
What is the InChIKey of fluoroform;pentahydrofluoride?
The InChIKey is SWQOMIDBKXUIMD-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3.5FH/c2-1(3)4;;;;;/h1H;5*1H.
What are the key properties of fluoroform;pentahydrofluoride?
fluoroform;pentahydrofluoride has a molecular weight of 170.04 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;pentahydrofluoride is sourced from PubChem (CID 173242263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).