About fluoroform;hydroiodide
fluoroform;hydroiodide (PubChem CID 87214980) has the molecular formula CH2F3I
and a molecular weight of 197.92 g/mol. Its IUPAC name is fluoroform;hydroiodide.
Molecular Properties
| Compound Name | fluoroform;hydroiodide |
| PubChem CID | 87214980 |
| Molecular Formula | CH2F3I |
| Molecular Weight | 197.92 g/mol |
| Exact Mass | 197.92 |
| IUPAC Name | fluoroform;hydroiodide |
| SMILES | FC(F)F.I |
| InChI | InChI=1S/CHF3.HI/c2-1(3)4;/h1H;1H |
| InChIKey | VBFKOAUPUOAIFJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.92 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze fluoroform;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;hydroiodide?
The IUPAC name of fluoroform;hydroiodide (CID 87214980) is fluoroform;hydroiodide.
What is the SMILES notation for fluoroform;hydroiodide?
The canonical SMILES for fluoroform;hydroiodide is FC(F)F.I.
What is the InChIKey of fluoroform;hydroiodide?
The InChIKey is VBFKOAUPUOAIFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3.HI/c2-1(3)4;/h1H;1H.
What are the key properties of fluoroform;hydroiodide?
fluoroform;hydroiodide has a molecular weight of 197.92 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;hydroiodide is sourced from PubChem (CID 87214980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).