About CID 174339830
CID 174339830 (PubChem CID 174339830) has the molecular formula CH2AgF3NS
and a molecular weight of 224.96 g/mol.
Molecular Properties
| Compound Name | CID 174339830 |
| PubChem CID | 174339830 |
| Molecular Formula | CH2AgF3NS |
| Molecular Weight | 224.96 g/mol |
| Exact Mass | 223.89 |
| IUPAC Name | — |
| SMILES | FC(F)F.N=S.[Ag] |
| InChI | InChI=1S/CHF3.Ag.HNS/c2-1(3)4;;1-2/h1H;;1H |
| InChIKey | MZIIEGFKJGKAQP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.96 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 174339830 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174339830?
The IUPAC name of CID 174339830 (CID 174339830) is not available.
What is the SMILES notation for CID 174339830?
The canonical SMILES for CID 174339830 is FC(F)F.N=S.[Ag].
What is the InChIKey of CID 174339830?
The InChIKey is MZIIEGFKJGKAQP-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3.Ag.HNS/c2-1(3)4;;1-2/h1H;;1H.
What are the key properties of CID 174339830?
CID 174339830 has a molecular weight of 224.96 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174339830 is sourced from PubChem (CID 174339830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).