About fluoroform;manganese(2+)
fluoroform;manganese(2+) (PubChem CID 162541967) has the molecular formula CHF3Mn+2
and a molecular weight of 124.95 g/mol. Its IUPAC name is fluoroform;manganese(2+).
Molecular Properties
| Compound Name | fluoroform;manganese(2+) |
| PubChem CID | 162541967 |
| Molecular Formula | CHF3Mn+2 |
| Molecular Weight | 124.95 g/mol |
| Exact Mass | 124.94 |
| IUPAC Name | fluoroform;manganese(2+) |
| SMILES | FC(F)F.[Mn+2] |
| InChI | InChI=1S/CHF3.Mn/c2-1(3)4;/h1H;/q;+2 |
| InChIKey | HBSWPMYUGALASP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.95 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze fluoroform;manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;manganese(2+)?
The IUPAC name of fluoroform;manganese(2+) (CID 162541967) is fluoroform;manganese(2+).
What is the SMILES notation for fluoroform;manganese(2+)?
The canonical SMILES for fluoroform;manganese(2+) is FC(F)F.[Mn+2].
What is the InChIKey of fluoroform;manganese(2+)?
The InChIKey is HBSWPMYUGALASP-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3.Mn/c2-1(3)4;/h1H;/q;+2.
What are the key properties of fluoroform;manganese(2+)?
fluoroform;manganese(2+) has a molecular weight of 124.95 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;manganese(2+) is sourced from PubChem (CID 162541967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).