About fluoroform tritetrafluoroborate
fluoroform tritetrafluoroborate (PubChem CID 173052592) has the molecular formula CHB3F15-3
and a molecular weight of 330.43 g/mol. Its IUPAC name is fluoroform tritetrafluoroborate.
Molecular Properties
| Compound Name | fluoroform tritetrafluoroborate |
| PubChem CID | 173052592 |
| Molecular Formula | CHB3F15-3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | fluoroform tritetrafluoroborate |
| SMILES | FC(F)F.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/CHF3.3BF4/c2-1(3)4;3*2-1(3,4)5/h1H;;;/q;3*-1 |
| InChIKey | OPNQPOROQRXBBE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluoroform tritetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform tritetrafluoroborate?
The IUPAC name of fluoroform tritetrafluoroborate (CID 173052592) is fluoroform tritetrafluoroborate.
What is the SMILES notation for fluoroform tritetrafluoroborate?
The canonical SMILES for fluoroform tritetrafluoroborate is FC(F)F.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.
What is the InChIKey of fluoroform tritetrafluoroborate?
The InChIKey is OPNQPOROQRXBBE-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3.3BF4/c2-1(3)4;3*2-1(3,4)5/h1H;;;/q;3*-1.
What are the key properties of fluoroform tritetrafluoroborate?
fluoroform tritetrafluoroborate has a molecular weight of 330.43 g/mol, XLogP of 5.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform tritetrafluoroborate is sourced from PubChem (CID 173052592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).