About lithium ditetrafluoroborate
lithium ditetrafluoroborate (PubChem CID 23116051) has the molecular formula B2F8Li-
and a molecular weight of 180.55 g/mol. Its IUPAC name is lithium ditetrafluoroborate.
Molecular Properties
| Compound Name | lithium ditetrafluoroborate |
| PubChem CID | 23116051 |
| Molecular Formula | B2F8Li- |
| Molecular Weight | 180.55 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | lithium ditetrafluoroborate |
| SMILES | F[B-](F)(F)F.F[B-](F)(F)F.[Li+] |
| InChI | InChI=1S/2BF4.Li/c2*2-1(3,4)5;/q2*-1;+1 |
| InChIKey | XNVMRLWNWRZTQA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.55 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium ditetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium ditetrafluoroborate?
The IUPAC name of lithium ditetrafluoroborate (CID 23116051) is lithium ditetrafluoroborate.
What is the SMILES notation for lithium ditetrafluoroborate?
The canonical SMILES for lithium ditetrafluoroborate is F[B-](F)(F)F.F[B-](F)(F)F.[Li+].
What is the InChIKey of lithium ditetrafluoroborate?
The InChIKey is XNVMRLWNWRZTQA-UHFFFAOYSA-N. The full InChI is InChI=1S/2BF4.Li/c2*2-1(3,4)5;/q2*-1;+1.
What are the key properties of lithium ditetrafluoroborate?
lithium ditetrafluoroborate has a molecular weight of 180.55 g/mol, XLogP of -0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium ditetrafluoroborate is sourced from PubChem (CID 23116051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).