About cadmium(2+) ditetrafluoroborate
cadmium(2+) ditetrafluoroborate (PubChem CID 12886773) has the molecular formula B2CdF8
and a molecular weight of 286.02 g/mol. Its IUPAC name is cadmium(2+) ditetrafluoroborate.
Molecular Properties
| Compound Name | cadmium(2+) ditetrafluoroborate |
| PubChem CID | 12886773 |
| Molecular Formula | B2CdF8 |
| Molecular Weight | 286.02 g/mol |
| Exact Mass | 287.91 |
| IUPAC Name | cadmium(2+) ditetrafluoroborate |
| SMILES | F[B-](F)(F)F.F[B-](F)(F)F.[Cd+2] |
| InChI | InChI=1S/2BF4.Cd/c2*2-1(3,4)5;/q2*-1;+2 |
| InChIKey | NXOFSPIMFJTFSE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.02 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cadmium(2+) ditetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+) ditetrafluoroborate?
The IUPAC name of cadmium(2+) ditetrafluoroborate (CID 12886773) is cadmium(2+) ditetrafluoroborate.
What is the SMILES notation for cadmium(2+) ditetrafluoroborate?
The canonical SMILES for cadmium(2+) ditetrafluoroborate is F[B-](F)(F)F.F[B-](F)(F)F.[Cd+2].
What is the InChIKey of cadmium(2+) ditetrafluoroborate?
The InChIKey is NXOFSPIMFJTFSE-UHFFFAOYSA-N. The full InChI is InChI=1S/2BF4.Cd/c2*2-1(3,4)5;/q2*-1;+2.
What are the key properties of cadmium(2+) ditetrafluoroborate?
cadmium(2+) ditetrafluoroborate has a molecular weight of 286.02 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+) ditetrafluoroborate is sourced from PubChem (CID 12886773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).