About trichloranium;N,N-dimethylmethanamine
trichloranium;N,N-dimethylmethanamine (PubChem CID 172718165) has the molecular formula C3H15Cl3N+3
and a molecular weight of 171.52 g/mol. Its IUPAC name is trichloranium;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | trichloranium;N,N-dimethylmethanamine |
| PubChem CID | 172718165 |
| Molecular Formula | C3H15Cl3N+3 |
| Molecular Weight | 171.52 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | trichloranium;N,N-dimethylmethanamine |
| SMILES | CN(C)C.[ClH2+].[ClH2+].[ClH2+] |
| InChI | InChI=1S/C3H9N.3ClH2/c1-4(2)3;;;/h1-3H3;3*1H2/q;3*+1 |
| InChIKey | PGOUGQBPOWCRTF-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.52 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trichloranium;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloranium;N,N-dimethylmethanamine?
The IUPAC name of trichloranium;N,N-dimethylmethanamine (CID 172718165) is trichloranium;N,N-dimethylmethanamine.
What is the SMILES notation for trichloranium;N,N-dimethylmethanamine?
The canonical SMILES for trichloranium;N,N-dimethylmethanamine is CN(C)C.[ClH2+].[ClH2+].[ClH2+].
What is the InChIKey of trichloranium;N,N-dimethylmethanamine?
The InChIKey is PGOUGQBPOWCRTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.3ClH2/c1-4(2)3;;;/h1-3H3;3*1H2/q;3*+1.
What are the key properties of trichloranium;N,N-dimethylmethanamine?
trichloranium;N,N-dimethylmethanamine has a molecular weight of 171.52 g/mol, XLogP of -1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trichloranium;N,N-dimethylmethanamine is sourced from PubChem (CID 172718165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).