About N,N-dimethylmethanamine;hydrate;tetrahydrofluoride
N,N-dimethylmethanamine;hydrate;tetrahydrofluoride (PubChem CID 174375944) has the molecular formula C3H15F4NO
and a molecular weight of 157.15 g/mol. Its IUPAC name is N,N-dimethylmethanamine;hydrate;tetrahydrofluoride.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;hydrate;tetrahydrofluoride |
| PubChem CID | 174375944 |
| Molecular Formula | C3H15F4NO |
| Molecular Weight | 157.15 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | N,N-dimethylmethanamine;hydrate;tetrahydrofluoride |
| SMILES | CN(C)C.F.F.F.F.O |
| InChI | InChI=1S/C3H9N.4FH.H2O/c1-4(2)3;;;;;/h1-3H3;4*1H;1H2 |
| InChIKey | WYDVBUPXEYYGJI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.15 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylmethanamine;hydrate;tetrahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;hydrate;tetrahydrofluoride?
The IUPAC name of N,N-dimethylmethanamine;hydrate;tetrahydrofluoride (CID 174375944) is N,N-dimethylmethanamine;hydrate;tetrahydrofluoride.
What is the SMILES notation for N,N-dimethylmethanamine;hydrate;tetrahydrofluoride?
The canonical SMILES for N,N-dimethylmethanamine;hydrate;tetrahydrofluoride is CN(C)C.F.F.F.F.O.
What is the InChIKey of N,N-dimethylmethanamine;hydrate;tetrahydrofluoride?
The InChIKey is WYDVBUPXEYYGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.4FH.H2O/c1-4(2)3;;;;;/h1-3H3;4*1H;1H2.
What are the key properties of N,N-dimethylmethanamine;hydrate;tetrahydrofluoride?
N,N-dimethylmethanamine;hydrate;tetrahydrofluoride has a molecular weight of 157.15 g/mol, XLogP of -0.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;hydrate;tetrahydrofluoride is sourced from PubChem (CID 174375944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).