About N,N-dimethylmethanamine;phosphane;dihydrochloride
N,N-dimethylmethanamine;phosphane;dihydrochloride (PubChem CID 174651183) has the molecular formula C3H14Cl2NP
and a molecular weight of 166.03 g/mol. Its IUPAC name is N,N-dimethylmethanamine;phosphane;dihydrochloride.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;phosphane;dihydrochloride |
| PubChem CID | 174651183 |
| Molecular Formula | C3H14Cl2NP |
| Molecular Weight | 166.03 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | N,N-dimethylmethanamine;phosphane;dihydrochloride |
| SMILES | CN(C)C.Cl.Cl.P |
| InChI | InChI=1S/C3H9N.2ClH.H3P/c1-4(2)3;;;/h1-3H3;2*1H;1H3 |
| InChIKey | AAUWLAUVUKJERV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.03 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;phosphane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;phosphane;dihydrochloride?
The IUPAC name of N,N-dimethylmethanamine;phosphane;dihydrochloride (CID 174651183) is N,N-dimethylmethanamine;phosphane;dihydrochloride.
What is the SMILES notation for N,N-dimethylmethanamine;phosphane;dihydrochloride?
The canonical SMILES for N,N-dimethylmethanamine;phosphane;dihydrochloride is CN(C)C.Cl.Cl.P.
What is the InChIKey of N,N-dimethylmethanamine;phosphane;dihydrochloride?
The InChIKey is AAUWLAUVUKJERV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.2ClH.H3P/c1-4(2)3;;;/h1-3H3;2*1H;1H3.
What are the key properties of N,N-dimethylmethanamine;phosphane;dihydrochloride?
N,N-dimethylmethanamine;phosphane;dihydrochloride has a molecular weight of 166.03 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;phosphane;dihydrochloride is sourced from PubChem (CID 174651183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).