About ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane
ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane (PubChem CID 145053451) has the molecular formula C14H38FN
and a molecular weight of 239.46 g/mol. Its IUPAC name is ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane.
Molecular Properties
| Compound Name | ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane |
| PubChem CID | 145053451 |
| Molecular Formula | C14H38FN |
| Molecular Weight | 239.46 g/mol |
| Exact Mass | 239.30 |
| IUPAC Name | ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane |
| SMILES | CC.CC.CC.CC(C)C.CCN(C)CF |
| InChI | InChI=1S/C4H10FN.C4H10.3C2H6/c1-3-6(2)4-5;1-4(2)3;3*1-2/h3-4H2,1-2H3;4H,1-3H3;3*1-2H3 |
| InChIKey | JLKSSFYQHXKSSI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane?
The IUPAC name of ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane (CID 145053451) is ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane.
What is the SMILES notation for ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane?
The canonical SMILES for ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane is CC.CC.CC.CC(C)C.CCN(C)CF.
What is the InChIKey of ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane?
The InChIKey is JLKSSFYQHXKSSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10FN.C4H10.3C2H6/c1-3-6(2)4-5;1-4(2)3;3*1-2/h3-4H2,1-2H3;4H,1-3H3;3*1-2H3.
What are the key properties of ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane?
ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane has a molecular weight of 239.46 g/mol, XLogP of 5.61, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(fluoromethyl)-N-methylethanamine;2-methylpropane is sourced from PubChem (CID 145053451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).