C6H13F2N — CID 59154861
N-ethyl-2,3-difluoro-N-methylpropan-1-amine (PubChem CID 59154861) has the molecular formula C6H13F2N and a molecular weight of 137.17 g/mol. Its IUPAC name is N-ethyl-2,3-difluoro-N-methylpropan-1-amine.
| Compound Name | N-ethyl-2,3-difluoro-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 59154861 |
| Molecular Formula | C6H13F2N |
| Molecular Weight | 137.17 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | N-ethyl-2,3-difluoro-N-methylpropan-1-amine |
| SMILES | CCN(C)CC(F)CF |
| InChI | InChI=1S/C6H13F2N/c1-3-9(2)5-6(8)4-7/h6H,3-5H2,1-2H3 |
| InChIKey | ZCOCFFQSPQJPEG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.17 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |